API16 products
Antitumor
Small-molecule kinase inhibitors including Gefitinib, Erlotinib, Sorafenib, Imatinib and Ibrutinib.
View productsAPIs and pharmaceutical intermediates
110 products across nine categories — 41 active pharmaceutical ingredients and 69 synthesis intermediates. Search the full catalog by product name or CAS number, or browse by category below.
Search
Full product index
Every listed product in one table. For specifications, current availability and lead times, contact us with the CAS number.
| Product name | CAS number | Category | Type |
|---|---|---|---|
| Gefitinib | 184475-35-2 | Antitumor | API |
| Erlotinib Hydrochloride | 183319-69-9 | Antitumor | API |
| Sorafenib tosylate | 475207-59-1 | Antitumor | API |
| Sunitinib Malate | 341031-54-7 | Antitumor | API |
| Lapatinib Ditosylate | 388082-78-8 | Antitumor | API |
| Imatinib Mesylate | 220127-57-1 | Antitumor | API |
| Dasatinib | 302962-49-8 | Antitumor | API |
| Nilotinib | 641571-10-0 | Antitumor | API |
| Pazopanib HCL | 635702-64-6 | Antitumor | API |
| Vandetanib | 443913-73-3 | Antitumor | API |
| Axitinib | 319463-51-9 | Antitumor | API |
| Canertinib | 289499-45-2 | Antitumor | API |
| Afatinib | 439081-18-2 | Antitumor | API |
| Bosutinib | 380843-75-4 | Antitumor | API |
| Lenvatinib | 417716-92-8 | Antitumor | API |
| Ibrutinib | 936563-96-1 | Antitumor | API |
| Losartan Potassium | 124750-99-8 | Cardiovascular | API |
| Valsartan | 137862-53-4 | Cardiovascular | API |
| Apixaban | 503612-47-3 | Cardiovascular | API |
| Rivaroxaban | 366789-02-8 | Cardiovascular | API |
| Prasugrel | 150322-43-3 | Cardiovascular | API |
| Propranolol | 318-98-9 | Cardiovascular | API |
| Atorvastatine Calcium | 134523-03-8 | Cardiovascular | API |
| Rosuvastatine Calcium | 147098-20-2 | Cardiovascular | API |
| Etravirine | 269055-15-4 | Antiviral | API |
| Efavirenz | 154598-52-4 | Antiviral | API |
| Raltegravir Potassium | 871038-72-1 | Antiviral | API |
| Darunavir | 206361-99-1 | Antiviral | API |
| Oseltamivir | 196618-13-0 | Antiviral | API |
| Apremilast | 608141-41-9 | Antiviral | API |
| Vildagliptin | 274901-16-5 | Other APIs | API |
| Sitagliptin phosphate | 654671-77-9 | Other APIs | API |
| Amorolfine HCL | 78613-38-4 | Other APIs | API |
| Clotrimazole | 23593-75-1 | Other APIs | API |
| Terbinafine HCL | 78628-80-5 | Other APIs | API |
| Tadalafil | 171596-29-5 | Other APIs | API |
| Sildenafil | 139755-83-2 | Other APIs | API |
| Dapsone | 80-08-0 | Other APIs | API |
| Pramipexoli dihydrochloridum monohydricum | 191217-81-9 | Other APIs | API |
| Rebamipide | 90098-04-7 | Other APIs | API |
| Solifenacin succinate | 242478-38-2 | Other APIs | API |
| 3,4-Dihydro-7-methoxy-4-oxoquinazolin-6-yl acetate | 179688-53-0 | Antitumor | Intermediate |
| 7-Methoxy-6-(3-morpholin-4-yl-propoxy)-3H-quinazolin-4-one | 199327-61-2 | Antitumor | Intermediate |
| 2-Amino-4-methoxy-5-(3-morpholinopropoxy)benzonitrile | 675126-27-9 | Antitumor | Intermediate |
| N-(3-Chloropropyl)morpholine | 7357-67-7 | Antitumor | Intermediate |
| 3-Ethynyl aniline or (3-aminophenylacetylene) | 54060-30-9 | Antitumor | Intermediate |
| 6,7-Bis(2-methoxyethoxy)-4(3H)-quinazolinone | 179688-29-0 | Antitumor | Intermediate |
| 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid | 253870-02-9 | Antitumor | Intermediate |
| 5-Fluoro-2-oxindole | 56341-41-4 | Antitumor | Intermediate |
| 3-(trifluoromethyl)-5-(4-methyl-1H-imidazol-1-yl)benzenamine | 641571-11-1 | Antitumor | Intermediate |
| 4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]benzoic acid ethyl ester | 641569-97-3 | Antitumor | Intermediate |
| 2-Amino-N-(2-chloro-6-methylphenyl)thiazole -5-carboxamide | 302964-24-5 | Antitumor | Intermediate |
| 3-Chloro-4-(3-fluorobenzyloxy)aniline | 202197-26-0 | Antitumor | Intermediate |
| 6-Iodoquinazolin-4-one | 16064-08-7 | Antitumor | Intermediate |
| 5-Formyl-2-furyl boronic acid(FFBA) | 27329-70-0 | Antitumor | Intermediate |
| 2-Aminoethylmethylsulfone hydrochloride | 104458-24-4 | Antitumor | Intermediate |
| Imatinib Mesylate | 220127-57-1 | Antitumor | Intermediate |
| N-(2-Methyl-5-Nitrophenyl)-4-(Pyridin-3-yl)Pyrimidin-2-Amine | 152460-09-8 | Antitumor | Intermediate |
| 4-(4-Methylpiperazinomethyl)benzoic Acid Dihydrochloride | 106261-49-8 | Antitumor | Intermediate |
| N-(5-Amino-2-methylphenyl)-4-(3-pyridyl)-2-pyrimidineamine | 152460-10-1 | Antitumor | Intermediate |
| 4-(Chloromethyl)-N-(4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)phenyl)benzamide | 404844-11-7 | Antitumor | Intermediate |
| 4-chloro-N-methylpyridine-2-carboxamide | 220000-87-3 | Antitumor | Intermediate |
| 4-(4-Bromo-2-fluoroanilino)-7-hydroxy-6-methoxyquinazoline | 196603-96-0 | Antitumor | Intermediate |
| 4-N-(3-chloro-4-fluorophenyl)-7-[(3S)-oxolan-3-yl]oxyquinazoline-4,6-diamine | 314771-76-1 | Antitumor | Intermediate |
| S-(+)-3-Hydroxytetrahydofuran | 86087-23-2 | Antitumor | Intermediate |
| 3-Iodo-6-nitroindazole | 70315-70-7 | Antitumor | Intermediate |
| 6-Iodo-1H-indazole | 261953-36-0 | Antitumor | Intermediate |
| 6-Nitroindazole | 7597-18-4 | Antitumor | Intermediate |
| 3-(4-Phenoxyphenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine | 330786-24-8 | Antitumor | Intermediate |
| 4-Chloro-7-methoxyquinoline-6-carboxamide | 417721-36-9 | Antitumor | Intermediate |
| (R)-5-bromo-3-(1-(2,6-dichloro-3-fluorophenyl)ethoxy)pyridin-2-amine | 877399-00-3 | Antitumor | Intermediate |
| tert-Butyl 4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]piperidine-1-carboxylate | 877399-74-1 | Antitumor | Intermediate |
| 3-(Trifluoromethyl)-5,6,7,8-tetrahydro-1,2,4-triazolo-[4,3-a]pyrazine HCl | 762240-92-6 | Antidiabetic | Intermediate |
| Boc-(R)-3-Amino-4-(2,4,5-trifluorophenyl)butanoic acid | 486460-00-8 | Antidiabetic | Intermediate |
| Methyl 3-oxo-4-(2,4,5-trifluorophenyl)butanoate | 769195-26-8 | Antidiabetic | Intermediate |
| (2Z)-4-Oxo-4-[3-(trifluoromethyl)-5,6-dihydro-[1,2,4]triazolo[4,3-a]pyrazine-7(8H)-yl]-1-(2,4,5-trifluorophenyl)butan-2-one | 764667-65-4 | Antidiabetic | Intermediate |
| 3-Amino-1-hydroxyadamantane | 702-82-9 | Antidiabetic | Intermediate |
| L-Prolinamide | 7531-52-4 | Antidiabetic | Intermediate |
| (2S)-1-(Chloroacetyl)-2-pyrrolidinecarbonitrile | 207557-35-5 | Antidiabetic | Intermediate |
| 2-Butyl-4-chloro-5-formylimidazole | 83857-96-9 | Cardiovascular | Intermediate |
| 4’-[(2-butyl-4-chloro-5-hydroxymethyl)-1H-imidazol-1-yl)methyl]-[1,1’-Biphenyl]-2-carbonitrile | 114772-55-3 | Cardiovascular | Intermediate |
| Losartan | 114798-26-4 | Cardiovascular | Intermediate |
| L-Valine methyl ester hydrochloride | 6306-52-1 | Cardiovascular | Intermediate |
| L-VALINE, N-[(2'-CYANO[1,1'-BIPHENYL]-4-YL)METHYL]-, METHYL ESTER, MONOHYDROCHLORIDE | 482577-59-3 | Cardiovascular | Intermediate |
| Valsartan | 137862-53-4 | Cardiovascular | Intermediate |
| tert-Butyl (4R,6R)-2-[[[6-(2-4-fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)pyrrol-1-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate / （L-1） | 125971-95-1 | Cardiovascular | Intermediate |
| Atorvastatin tert-Butyl Ester / (L-2) | 134395-00-9 | Cardiovascular | Intermediate |
| 2-[(1-Naphthyloxy)methyl]oxirane | 2461-42-9 | Cardiovascular | Intermediate |
| 2-oxo-2,4,5,6,7,7a-hexahydrothieno [3, 2-c] pyridine. Hydrochloride | 115473-15-9 | Cardiovascular | Intermediate |
| 4-(4-Aminophenyl)morpholin-3-one | 438056-69-0 | Cardiovascular | Intermediate |
| (S)-(+)-N-(2,3-Epoxypropyl)phthalimide | 161596-47-0 | Cardiovascular | Intermediate |
| 5-Chloro-2-thiophenecarboxylic acid | 24065-33-6 | Cardiovascular | Intermediate |
| Ethyl chloro[(4-methoxyphenyl)hydrazono]acetate | 27143-07-3 | Cardiovascular | Intermediate |
| ethyl 6-(4-aMinophenyl)-1-(4-Methoxyphenyl)-7-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[3,4-c]pyridine-3-carboxylate | 503615-07-4 | Cardiovascular | Intermediate |
| 5,6-Dihydro-3-(4-morpholinyl)-1-[4-(2-oxo-1-piperidinyl)phenyl]-2(1H)-pyridinone | 545445-44-1 | Cardiovascular | Intermediate |
| (3R,4R,5S)-4-N-Acetyl(1,1-dimethylethyl)amino-5-N,N-diallylamino-3-(1-ethylpropoxy)-1-cyclohexene-1-carboxylic acid ethyl ester monohydrochloride | 651324-08-2 | Antiviral | Intermediate |
| (S)-1-(3-Ethoxy-4-Methoxyphenyl)-2-(Methylsulfonyl)ethylaMine N-acetyl-L-leucine salt | 608141-43-1 | Antiviral | Intermediate |
| 1,3-Dioxo-2-isoindolineaceticacid | 6296-53-3 | Antiviral | Intermediate |
| 4-Chloro-2-(trifluoroacetyl)aniline hydrochloride (E-2) | 173676-59-0 | Antiviral | Intermediate |
| (S)-1-(2-Amino-5-chlorophenyl)-1-(trifluoromethyl)-3-cyclopropyl-2-propyn-1-ol (E-6) | 209414-27-7 | Antiviral | Intermediate |
| 2-(1-AMINO-1-METHYLETHYL)-N-(4-FLUOROBENZYL)-5-HYDROXY-1-METHYL-6-OXO-1,6-DIHYDROPYRIMIDINE-4-CARBOXAMIDE | 518048-03-8 | Antiviral | Intermediate |
| BENZYL [1-[4-[[(4-FLUOROBENZYL)AMINO]CARBONYL]-5-HYDROXY-1-METHYL-6-OXO-1,6-DIHYDROPYRIMIDIN-2-YL]-1-METHYLETHYL]CARBAMATE | 518048-02-7 | Antiviral | Intermediate |
| 4-PYRIMIDINECARBOXYLIC ACID, 1,6-DIHYDRO-5-HYDROXY-2-[1-METHYL-1-[[(PHENYLMETHOXY)CARBONYL]AMINO]ETHYL]-6-OXO-, METHYL ESTER | 519032-08-7 | Antiviral | Intermediate |
| 5-Methyl-1,3,4-oxadiazole-2-carboxylic acid potassium salt | 888504-28-7 | Antiviral | Intermediate |
| [(8R)-1-azabicyclo[2.2.2]octan-8-yl] (1S)-1- phenyl-3,4-dihydro-1H-isoquinoline-2- carboxylate /Solifenacin(Free Base) | 242478-37-1 | Other intermediates | Intermediate |
| N-Methyl-1-naphthalenemethylamine hydrochloride | 65473-13-4 | Other intermediates | Intermediate |
| Rebamipide sodium salt | 169809-59-0 | Other intermediates | Intermediate |
| 2-[2-(2,2,2-trifluoroethoxy)phenoxy]-Ethanol,1-methanesulfonate | 160969-03-9 | Other intermediates | Intermediate |
| 5-[(2R)-2-Aminopropyl]-1-[3-(benzoyloxy)propyl]-2,3-dihydro-1H-indole-7-carbonitrile (2R,3R)-2,3-dihydroxybutanedioate | 239463-85-5 | Other intermediates | Intermediate |
| Ethyl 6,8-dichloro caprylate | 41443-60-1 | Other intermediates | Intermediate |
No products match your search. Try a shorter name fragment or a CAS number.
Family · 41 products
Active pharmaceutical ingredients
APIs manufactured to GMP standards and supplied with full analytical documentation.
API8 products
Cardiovascular
Sartans, statins and anticoagulants including Losartan, Valsartan, Apixaban and Rivaroxaban.
View productsAPI6 products
Antiviral
Antiretrovirals and antivirals including Efavirenz, Darunavir, Raltegravir and Oseltamivir.
View productsAPI11 products
Other APIs
Antidiabetics, antifungals and specialty APIs including Sitagliptin, Vildagliptin, Tadalafil and Terbinafine.
View productsFamily · 69 products
Pharmaceutical intermediates
Advanced synthesis intermediates with verified structures, supporting established API manufacturing routes. Molecular structures are shown on every category page.
Intermediate31 products
Antitumor
Quinazoline, pyrrole and indole building blocks for Gefitinib, Erlotinib and Sunitinib synthesis routes.
View productsIntermediate7 products
Antidiabetic
Key intermediates for Sitagliptin and Vildagliptin synthesis routes.
View productsIntermediate16 products
Cardiovascular
Imidazole and biphenyl building blocks for Losartan, Valsartan and Atorvastatin synthesis routes.
View productsIntermediate9 products
Antiviral
Advanced intermediates supporting Oseltamivir, Efavirenz, Raltegravir and Apremilast routes.
View productsIntermediate6 products
Other intermediates
Specialty intermediates for Solifenacin, Rebamipide, Silodosin and other routes.
View productsStart an inquiry
Ready to discuss your requirements?
Send us the product name or CAS number, the quantity you need, and your destination market — our team will respond with specifications, availability and lead times.